Compound Q&A

How is 3-(3-Nitrophenyl)pyridine (CAS: 4282-50-2) typically synthesized?

Answer

3-(3-Nitrophenyl)pyridine
3-(3-Nitrophenyl)pyridine is typically synthesized via electrophilic aromatic substitution. The reaction involves the nitration of 3-pyridylbenzene using nitric acid and sulfuric acid as the nitrating reagents. The yield is usually around 70-80%, and the reaction is carried out under mild conditions to ensure selectivity.

About

CAS No 4282-50-2
English Name 3-(3-Nitrophenyl)pyridine
Molecular Formula C11H8N2O2
Molecular Weight 200.19 g/mol
SMILES [O-][N+](=O)c1cccc(c1)c2cccnc2
InChIKey VNYZVWPHCFEYNE-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(3-Nitrophenyl)pyridine (CAS: 4282-50-2)?

3-(3-Nitrophenyl)pyridine is a crystalline solid with a molecular weight of approximately 220.08 g/m...

Compound Q&A

What industries use 3-(3-Nitrophenyl)pyridine (CAS: 4282-50-2)?

3-(3-Nitrophenyl)pyridine finds applications in pharmaceuticals, where it serves as a precursor for ...

Compound Q&A

What precautions should be taken when handling 3-(3-Nitrophenyl)pyridine (CAS: 4282-50-2)?

When handling 3-(3-Nitrophenyl)pyridine, it is essential to wear appropriate personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...