Compound Q&A

What are the physical and chemical properties of 3-(3-Nitrophenyl)pyridine (CAS: 4282-50-2)?

Answer

3-(3-Nitrophenyl)pyridine
3-(3-Nitrophenyl)pyridine is a crystalline solid with a molecular weight of approximately 220.08 g/mol. It has a low solubility in water but is soluble in common organic solvents like dichloromethane and ethanol. This compound is relatively stable but can decompose under strong reducing conditions. It shows moderate reactivity towards nucleophiles and electrophiles.

About

CAS No 4282-50-2
English Name 3-(3-Nitrophenyl)pyridine
Molecular Formula C11H8N2O2
Molecular Weight 200.19 g/mol
SMILES [O-][N+](=O)c1cccc(c1)c2cccnc2
InChIKey VNYZVWPHCFEYNE-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

How is 3-(3-Nitrophenyl)pyridine (CAS: 4282-50-2) typically synthesized?

3-(3-Nitrophenyl)pyridine is typically synthesized via electrophilic aromatic substitution. The reac...

Compound Q&A

What industries use 3-(3-Nitrophenyl)pyridine (CAS: 4282-50-2)?

3-(3-Nitrophenyl)pyridine finds applications in pharmaceuticals, where it serves as a precursor for ...

Compound Q&A

What precautions should be taken when handling 3-(3-Nitrophenyl)pyridine (CAS: 4282-50-2)?

When handling 3-(3-Nitrophenyl)pyridine, it is essential to wear appropriate personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...