Compound Q&A

What precautions should be taken when handling 3-[4-(Benzyloxy)phenyl]propanoic acid (CAS: 50463-48-4)?

Answer

3-[4-(Benzyloxy)phenyl]propanoic acid
When handling 3-[4-(Benzyloxy)phenyl]propanoic acid, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. It should be stored in a cool, dry place away from direct sunlight and heat sources. In case of a spill, use appropriate spill response equipment and follow safety data sheet (SDS) guidelines. Regular fume hood use is recommended during handling to minimize exposure to vapors.

About

CAS No 50463-48-4
English Name 3-[4-(Benzyloxy)phenyl]propanoic acid
Molecular Formula C16H16O3
Molecular Weight 256.3 g/mol
SMILES OC(=O)CCc1ccc(OCc2ccccc2)cc1
InChIKey QTSAUVQZNADEKS-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-[4-(Benzyloxy)phenyl]propanoic acid (CAS: 50463-48-4)?

3-[4-(Benzyloxy)phenyl]propanoic acid is a white crystalline solid with a molecular weight of approx...

Compound Q&A

How is 3-[4-(Benzyloxy)phenyl]propanoic acid (CAS: 50463-48-4) typically synthesized?

3-[4-(Benzyloxy)phenyl]propanoic acid is typically synthesized via a multi-step process. Benzyl brom...

Compound Q&A

What industries use 3-[4-(Benzyloxy)phenyl]propanoic acid (CAS: 50463-48-4)?

3-[4-(Benzyloxy)phenyl]propanoic acid finds applications in the pharmaceutical industry for medicina...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...