Compound Q&A

What are the physical and chemical properties of 3-[4-(Benzyloxy)phenyl]propanoic acid (CAS: 50463-48-4)?

Answer

3-[4-(Benzyloxy)phenyl]propanoic acid
3-[4-(Benzyloxy)phenyl]propanoic acid is a white crystalline solid with a molecular weight of approximately 284.3 g/mol. It is poorly soluble in water but soluble in most organic solvents. Chemically, it is relatively stable but can undergo hydrolysis under basic conditions. It is known for its weak acidity and can react with bases to form salts.

About

CAS No 50463-48-4
English Name 3-[4-(Benzyloxy)phenyl]propanoic acid
Molecular Formula C16H16O3
Molecular Weight 256.3 g/mol
SMILES OC(=O)CCc1ccc(OCc2ccccc2)cc1
InChIKey QTSAUVQZNADEKS-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

How is 3-[4-(Benzyloxy)phenyl]propanoic acid (CAS: 50463-48-4) typically synthesized?

3-[4-(Benzyloxy)phenyl]propanoic acid is typically synthesized via a multi-step process. Benzyl brom...

Compound Q&A

What industries use 3-[4-(Benzyloxy)phenyl]propanoic acid (CAS: 50463-48-4)?

3-[4-(Benzyloxy)phenyl]propanoic acid finds applications in the pharmaceutical industry for medicina...

Compound Q&A

What precautions should be taken when handling 3-[4-(Benzyloxy)phenyl]propanoic acid (CAS: 50463-48-4)?

When handling 3-[4-(Benzyloxy)phenyl]propanoic acid, it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...