Compound Q&A

How is 3-[4-(Benzyloxy)phenyl]propanoic acid (CAS: 50463-48-4) typically synthesized?

Answer

3-[4-(Benzyloxy)phenyl]propanoic acid
3-[4-(Benzyloxy)phenyl]propanoic acid is typically synthesized via a multi-step process. Benzyl bromide reacts with 4-hydroxybenzoic acid in the presence of a base like sodium hydride to form the intermediate, which is then oxidized to the carboxylic acid. This process yields the target compound with good selectivity and can achieve up to 85% yield.

About

CAS No 50463-48-4
English Name 3-[4-(Benzyloxy)phenyl]propanoic acid
Molecular Formula C16H16O3
Molecular Weight 256.3 g/mol
SMILES OC(=O)CCc1ccc(OCc2ccccc2)cc1
InChIKey QTSAUVQZNADEKS-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-[4-(Benzyloxy)phenyl]propanoic acid (CAS: 50463-48-4)?

3-[4-(Benzyloxy)phenyl]propanoic acid is a white crystalline solid with a molecular weight of approx...

Compound Q&A

What industries use 3-[4-(Benzyloxy)phenyl]propanoic acid (CAS: 50463-48-4)?

3-[4-(Benzyloxy)phenyl]propanoic acid finds applications in the pharmaceutical industry for medicina...

Compound Q&A

What precautions should be taken when handling 3-[4-(Benzyloxy)phenyl]propanoic acid (CAS: 50463-48-4)?

When handling 3-[4-(Benzyloxy)phenyl]propanoic acid, it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...