Compound Q&A

How is Ganaxolone (CAS: 38398-32-2) typically synthesized?

Answer

Ganaxolone
Ganaxolone is typically synthesized via a multi-step process involving the condensation of a suitable aldehyde with a vicinal diol, followed by a series of reduction and protection/deprotection steps. Common catalysts include palladium-based catalysts, and the overall yield is around 60-70%. The synthetic route is selective and efficient.

About

CAS No 38398-32-2
English Name Ganaxolone
Molecular Formula C22H36O2
Molecular Weight 332.5 g/mol
SMILES CC(=O)C1CCC2C1(CCC3C2CCC4C3(CCC(C4)(C)O)C)C
InChIKey PGTVWKLGGCQMBR-FLBATMFCSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ganaxolone (CAS: 38398-32-2)?

Ganaxolone (CAS: 38398-32-2) is a white to off-white crystalline powder. Its molecular formula is C2...

Compound Q&A

What industries use Ganaxolone (CAS: 38398-32-2)?

Ganaxolone (CAS: 38398-32-2) is primarily used in the pharmaceutical industry due to its potential a...

Compound Q&A

What precautions should be taken when handling Ganaxolone (CAS: 38398-32-2)?

Ganaxolone should be handled with caution in a well-ventilated area, preferably in a fume hood. It i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...