Compound Q&A

What are the physical and chemical properties of Ganaxolone (CAS: 38398-32-2)?

Answer

Ganaxolone
Ganaxolone (CAS: 38398-32-2) is a white to off-white crystalline powder. Its molecular formula is C21H34O3, and the molecular weight is 338.53 g/mol. Ganaxolone is poorly soluble in water but soluble in ethanol. It is relatively stable under normal conditions, but its solubility in organic solvents can affect its reactivity.

About

CAS No 38398-32-2
English Name Ganaxolone
Molecular Formula C22H36O2
Molecular Weight 332.5 g/mol
SMILES CC(=O)C1CCC2C1(CCC3C2CCC4C3(CCC(C4)(C)O)C)C
InChIKey PGTVWKLGGCQMBR-FLBATMFCSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

How is Ganaxolone (CAS: 38398-32-2) typically synthesized?

Ganaxolone is typically synthesized via a multi-step process involving the condensation of a suitabl...

Compound Q&A

What industries use Ganaxolone (CAS: 38398-32-2)?

Ganaxolone (CAS: 38398-32-2) is primarily used in the pharmaceutical industry due to its potential a...

Compound Q&A

What precautions should be taken when handling Ganaxolone (CAS: 38398-32-2)?

Ganaxolone should be handled with caution in a well-ventilated area, preferably in a fume hood. It i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...