Compound Q&A

What industries use 4'-Methyl-3-nitro-1,1'-biphenyl (CAS: 53812-68-3)?

Answer

4'-Methyl-3-nitro-1,1'-biphenyl
4'-Methyl-3-nitro-1,1'-biphenyl (CAS: 53812-68-3) is used primarily in the pharmaceutical and polymer industries for the synthesis of intermediates and functional materials. It can also be applied in the development of sensors and electronic devices due to its unique electronic properties.

About

CAS No 53812-68-3
English Name 4'-Methyl-3-nitro-1,1'-biphenyl
Molecular Formula C13H11NO2
Molecular Weight 213.2319 g/mol
SMILES CC1=CC=C(C=C1)C2=CC(=CC=C2)[N+](=O)[O-]
InChIKey VXPLSDQTIWIHJH-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4'-Methyl-3-nitro-1,1'-biphenyl (CAS: 53812-68-3)?

4'-Methyl-3-nitro-1,1'-biphenyl (CAS: 53812-68-3) is a crystalline solid with a molecular weight of ...

Compound Q&A

How is 4'-Methyl-3-nitro-1,1'-biphenyl (CAS: 53812-68-3) typically synthesized?

4'-Methyl-3-nitro-1,1'-biphenyl is typically synthesized via the nitration of 4'-methyl-1,1'-bipheny...

Compound Q&A

What precautions should be taken when handling 4'-Methyl-3-nitro-1,1'-biphenyl (CAS: 53812-68-3)?

When handling 4'-Methyl-3-nitro-1,1'-biphenyl (CAS: 53812-68-3), appropriate personal protective equ...

Compound Q&A

Is 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3) safe?

6-(3-Fluorophenyl)picolinic acid is generally considered safe for laboratory use...

887982-40-36-(3-Fluorophenyl)pi...
Compound Q&A

What industries use (3R)-3-Pyrrolidinol (CAS: 2799-21-5)?

(3R)-3-Pyrrolidinol is used in the pharmaceutical industry as a precursor for dr...

2799-21-5(3R)-3-Pyrrolidinol
Compound Q&A

What precautions should be taken when handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

When handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-...

59779-75-8(4R,5R)-4,5-Diethoxy...
Compound Q&A

How is 1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone (CAS: 90734-71-7) typically synthesized?

1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone is often synthesized via a mult...

90734-71-71-(6-Chloroimidazo[1...