Compound Q&A

How is 4'-Methyl-3-nitro-1,1'-biphenyl (CAS: 53812-68-3) typically synthesized?

Answer

4'-Methyl-3-nitro-1,1'-biphenyl
4'-Methyl-3-nitro-1,1'-biphenyl is typically synthesized via the nitration of 4'-methyl-1,1'-biphenyl followed by further nitration. Nitration is often carried out using a mixture of nitric acid and sulfuric acid. The reaction conditions should be carefully controlled to achieve high selectivity and yield, usually requiring the use of a suitable catalyst and proper temperature control.

About

CAS No 53812-68-3
English Name 4'-Methyl-3-nitro-1,1'-biphenyl
Molecular Formula C13H11NO2
Molecular Weight 213.2319 g/mol
SMILES CC1=CC=C(C=C1)C2=CC(=CC=C2)[N+](=O)[O-]
InChIKey VXPLSDQTIWIHJH-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4'-Methyl-3-nitro-1,1'-biphenyl (CAS: 53812-68-3)?

4'-Methyl-3-nitro-1,1'-biphenyl (CAS: 53812-68-3) is a crystalline solid with a molecular weight of ...

Compound Q&A

What industries use 4'-Methyl-3-nitro-1,1'-biphenyl (CAS: 53812-68-3)?

4'-Methyl-3-nitro-1,1'-biphenyl (CAS: 53812-68-3) is used primarily in the pharmaceutical and polyme...

Compound Q&A

What precautions should be taken when handling 4'-Methyl-3-nitro-1,1'-biphenyl (CAS: 53812-68-3)?

When handling 4'-Methyl-3-nitro-1,1'-biphenyl (CAS: 53812-68-3), appropriate personal protective equ...

Compound Q&A

Is 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3) safe?

6-(3-Fluorophenyl)picolinic acid is generally considered safe for laboratory use...

887982-40-36-(3-Fluorophenyl)pi...
Compound Q&A

What industries use (3R)-3-Pyrrolidinol (CAS: 2799-21-5)?

(3R)-3-Pyrrolidinol is used in the pharmaceutical industry as a precursor for dr...

2799-21-5(3R)-3-Pyrrolidinol
Compound Q&A

What precautions should be taken when handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

When handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-...

59779-75-8(4R,5R)-4,5-Diethoxy...
Compound Q&A

How is 1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone (CAS: 90734-71-7) typically synthesized?

1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone is often synthesized via a mult...

90734-71-71-(6-Chloroimidazo[1...