Compound Q&A

What industries use Diphenyl carbonate (CAS: 29862-10-0)?

Answer

Diphenyl carbonate;hexane-1,6-diol
Diphenyl carbonate (CAS: 29862-10-0) is widely used in the pharmaceutical, polymer, and sensor industries. In pharmaceuticals, it serves as a precursor for the synthesis of antiretroviral drugs. In polymers, it is used in the production of polyesters and carbonates. Additionally, it finds applications in the development of gas sensors and as a stabilizer in polymer formulations.

About

CAS No 29862-10-0
English Name Diphenyl carbonate;hexane-1,6-diol
Molecular Formula C13H10O3.C6H14O2
Molecular Weight 332.39 g/mol
SMILES C1=CC=C(C=C1)OC(=O)OC2=CC=CC=C2.C(CCCO)CCO
InChIKey FCVCFERLLIDEQL-UHFFFAOYSA-N
Last Updated: 2026-01-01 10:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of Diphenyl carbonate (CAS: 29862-10-0)?

Diphenyl carbonate (CAS: 29862-10-0) is a colorless to white crystalline solid with a molecular weig...

Compound Q&A

How is Diphenyl carbonate (CAS: 29862-10-0) typically synthesized?

Diphenyl carbonate (CAS: 29862-10-0) is typically synthesized by the esterification of phosgene with...

Compound Q&A

What precautions should be taken when handling Diphenyl carbonate (CAS: 29862-10-0)?

When handling Diphenyl carbonate (CAS: 29862-10-0), it is essential to use appropriate Personal Prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...