Compound Q&A

What are the physical and chemical properties of Diphenyl carbonate (CAS: 29862-10-0)?

Answer

Diphenyl carbonate;hexane-1,6-diol
Diphenyl carbonate (CAS: 29862-10-0) is a colorless to white crystalline solid with a molecular weight of approximately 196.15 g/mol. It has a low solubility in water (0.02 g/100 mL at 25°C) but is soluble in organic solvents like benzene and chloroform. Chemically, it is reactive towards bases and nucleophiles, making it useful in various polymerization reactions and as a precursor in pharmaceuticals and materials science.

About

CAS No 29862-10-0
English Name Diphenyl carbonate;hexane-1,6-diol
Molecular Formula C13H10O3.C6H14O2
Molecular Weight 332.39 g/mol
SMILES C1=CC=C(C=C1)OC(=O)OC2=CC=CC=C2.C(CCCO)CCO
InChIKey FCVCFERLLIDEQL-UHFFFAOYSA-N
Last Updated: 2026-01-01 10:50

Related Q&A

Compound Q&A

How is Diphenyl carbonate (CAS: 29862-10-0) typically synthesized?

Diphenyl carbonate (CAS: 29862-10-0) is typically synthesized by the esterification of phosgene with...

Compound Q&A

What industries use Diphenyl carbonate (CAS: 29862-10-0)?

Diphenyl carbonate (CAS: 29862-10-0) is widely used in the pharmaceutical, polymer, and sensor indus...

Compound Q&A

What precautions should be taken when handling Diphenyl carbonate (CAS: 29862-10-0)?

When handling Diphenyl carbonate (CAS: 29862-10-0), it is essential to use appropriate Personal Prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...