Compound Q&A

What industries use (6,6'-Dimethoxy-2,2'-biphenyldiyl)bis[bis(3,4,5-trimethoxyphenyl)phosphine] (CAS: 256390-47-3)?

Answer

(6,6'-Dimethoxy-2,2'-biphenyldiyl)bis[bis(3,4,5-trimethoxyphenyl)phosphine]
This compound is used in the pharmaceutical industry for its potential in drug synthesis, as well as in the semiconductor industry for its use as a dopant. It also has applications in sensors due to its reactivity and stability.

About

English Name (6,6'-Dimethoxy-2,2'-biphenyldiyl)bis[bis(3,4,5-trimethoxyphenyl)phosphine]
Molecular Formula C50H56O14P2
Molecular Weight 942.93 g/mol
SMILES COC1=C(C(=CC=C1)P(C2=CC(=C(C(=C2)OC)OC)OC)C3=CC(=C(C(=C3)OC)OC)OC)C4=C(C=CC=C4P(C5=CC(=C(C(=C5)OC)OC)OC)C6=CC(=C(C(=C6)OC)OC)OC)OC
InChIKey JZCMGMXFWZWFRX-UHFFFAOYSA-N
Last Updated: 2026-01-01 10:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of (6,6'-Dimethoxy-2,2'-biphenyldiyl)bis[bis(3,4,5-trimethoxyphenyl)phosphine] (CAS: 256390-47-3)?

This compound has a crystalline form with a molecular weight of approximately 1016.46 g/mol. It is p...

Compound Q&A

How is (6,6'-Dimethoxy-2,2'-biphenyldiyl)bis[bis(3,4,5-trimethoxyphenyl)phosphine] (CAS: 256390-47-3) typically synthesized?

This compound is typically synthesized via a multistep process involving the coupling of 2,2'-biphen...

Compound Q&A

What precautions should be taken when handling (6,6'-Dimethoxy-2,2'-biphenyldiyl)bis[bis(3,4,5-trimethoxyphenyl)phosphine] (CAS: 256390-47-3)?

Proper personal protective equipment (PPE) including gloves, goggles, and a lab coat should be worn....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...