Compound Q&A

What are the physical and chemical properties of (6,6'-Dimethoxy-2,2'-biphenyldiyl)bis[bis(3,4,5-trimethoxyphenyl)phosphine] (CAS: 256390-47-3)?

Answer

(6,6'-Dimethoxy-2,2'-biphenyldiyl)bis[bis(3,4,5-trimethoxyphenyl)phosphine]
This compound has a crystalline form with a molecular weight of approximately 1016.46 g/mol. It is poorly soluble in water but soluble in organic solvents like acetone and ethyl acetate. Chemically, it is highly reactive due to the presence of multiple functional groups.

About

English Name (6,6'-Dimethoxy-2,2'-biphenyldiyl)bis[bis(3,4,5-trimethoxyphenyl)phosphine]
Molecular Formula C50H56O14P2
Molecular Weight 942.93 g/mol
SMILES COC1=C(C(=CC=C1)P(C2=CC(=C(C(=C2)OC)OC)OC)C3=CC(=C(C(=C3)OC)OC)OC)C4=C(C=CC=C4P(C5=CC(=C(C(=C5)OC)OC)OC)C6=CC(=C(C(=C6)OC)OC)OC)OC
InChIKey JZCMGMXFWZWFRX-UHFFFAOYSA-N
Last Updated: 2026-01-01 10:50

Related Q&A

Compound Q&A

How is (6,6'-Dimethoxy-2,2'-biphenyldiyl)bis[bis(3,4,5-trimethoxyphenyl)phosphine] (CAS: 256390-47-3) typically synthesized?

This compound is typically synthesized via a multistep process involving the coupling of 2,2'-biphen...

Compound Q&A

What industries use (6,6'-Dimethoxy-2,2'-biphenyldiyl)bis[bis(3,4,5-trimethoxyphenyl)phosphine] (CAS: 256390-47-3)?

This compound is used in the pharmaceutical industry for its potential in drug synthesis, as well as...

Compound Q&A

What precautions should be taken when handling (6,6'-Dimethoxy-2,2'-biphenyldiyl)bis[bis(3,4,5-trimethoxyphenyl)phosphine] (CAS: 256390-47-3)?

Proper personal protective equipment (PPE) including gloves, goggles, and a lab coat should be worn....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...