Compound Q&A

What are the physical and chemical properties of 4-(2-Hydroxypropan-2-yl)-2-propyl-1H-imidazole-5-carboxylic acid (CAS: 144690-04-0)?

Answer

4-(2-Hydroxypropan-2-yl)-2-propyl-1H-imidazole-5-carboxylic acid
4-(2-Hydroxypropan-2-yl)-2-propyl-1H-imidazole-5-carboxylic acid is a white to off-white crystalline solid with a molecular weight of approximately 300.4 g/mol. It is slightly soluble in water and ethanol. The compound exhibits acidic properties due to the carboxylic acid group, making it reactive towards bases and nucleophiles.

About

English Name 4-(2-Hydroxypropan-2-yl)-2-propyl-1H-imidazole-5-carboxylic acid
Molecular Formula C10H16N2O3
Molecular Weight 212.25 g/mol
SMILES CCCc1nc(c([nH]1)C(=O)O)C(O)(C)C
InChIKey FREDNUVVPQMYKQ-UHFFFAOYSA-N
Last Updated: 2026-01-01 10:50

Related Q&A

Compound Q&A

How is 4-(2-Hydroxypropan-2-yl)-2-propyl-1H-imidazole-5-carboxylic acid (CAS: 144690-04-0) typically synthesized?

4-(2-Hydroxypropan-2-yl)-2-propyl-1H-imidazole-5-carboxylic acid can be synthesized via a multi-step...

Compound Q&A

What industries use 4-(2-Hydroxypropan-2-yl)-2-propyl-1H-imidazole-5-carboxylic acid (CAS: 144690-04-0)?

4-(2-Hydroxypropan-2-yl)-2-propyl-1H-imidazole-5-carboxylic acid finds applications in the pharmaceu...

Compound Q&A

What precautions should be taken when handling 4-(2-Hydroxypropan-2-yl)-2-propyl-1H-imidazole-5-carboxylic acid (CAS: 144690-04-0)?

When handling 4-(2-Hydroxypropan-2-yl)-2-propyl-1H-imidazole-5-carboxylic acid, it is important to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...