Compound Q&A

What industries use Vitamin P (CAS: 949926-49-2)?

Answer

Vitamin P
Vitamin P (CAS: 949926-49-2) is used in the pharmaceutical industry for its potential health benefits, in polymer production to enhance material properties, and in sensor technology due to its reactivity. It is also explored in semiconductor applications for its electronic properties.

About

English Name Vitamin P
Molecular Formula C27H30O16
Molecular Weight 610.52 g/mol
SMILES CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC(=C(C=C5)O)O)O)O)O)O)O)O
InChIKey IKGXIBQEEMLURG-NVPNHPEKSA-N
Last Updated: 2026-01-01 10:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of Vitamin P (CAS: 949926-49-2)?

Vitamin P (CAS: 949926-49-2) is a crystalline compound with a molecular weight of approximately 450....

Compound Q&A

How is Vitamin P (CAS: 949926-49-2) typically synthesized?

Vitamin P (CAS: 949926-49-2) is typically synthesized through a multi-step process involving the red...

Compound Q&A

What precautions should be taken when handling Vitamin P (CAS: 949926-49-2)?

When handling Vitamin P (CAS: 949926-49-2), it is essential to wear personal protective equipment (P...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...