Compound Q&A

What are the physical and chemical properties of Vitamin P (CAS: 949926-49-2)?

Answer

Vitamin P
Vitamin P (CAS: 949926-49-2) is a crystalline compound with a molecular weight of approximately 450.58 g/mol. It is poorly soluble in water but soluble in organic solvents. It is relatively stable under normal conditions but reacts with strong acids and bases. Its reactivity is generally low, but it can undergo hydrolysis under certain conditions.

About

English Name Vitamin P
Molecular Formula C27H30O16
Molecular Weight 610.52 g/mol
SMILES CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC(=C(C=C5)O)O)O)O)O)O)O)O
InChIKey IKGXIBQEEMLURG-NVPNHPEKSA-N
Last Updated: 2026-01-01 10:50

Related Q&A

Compound Q&A

How is Vitamin P (CAS: 949926-49-2) typically synthesized?

Vitamin P (CAS: 949926-49-2) is typically synthesized through a multi-step process involving the red...

Compound Q&A

What industries use Vitamin P (CAS: 949926-49-2)?

Vitamin P (CAS: 949926-49-2) is used in the pharmaceutical industry for its potential health benefit...

Compound Q&A

What precautions should be taken when handling Vitamin P (CAS: 949926-49-2)?

When handling Vitamin P (CAS: 949926-49-2), it is essential to wear personal protective equipment (P...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...