Compound Q&A

How is Vitamin P (CAS: 949926-49-2) typically synthesized?

Answer

Vitamin P
Vitamin P (CAS: 949926-49-2) is typically synthesized through a multi-step process involving the reduction of a suitable precursor, followed by purification steps. Common catalysts include palladium-based catalysts. The yield is generally good, and the selectivity is high, making it a feasible and industrially viable synthesis method.

About

English Name Vitamin P
Molecular Formula C27H30O16
Molecular Weight 610.52 g/mol
SMILES CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC(=C(C=C5)O)O)O)O)O)O)O)O
InChIKey IKGXIBQEEMLURG-NVPNHPEKSA-N
Last Updated: 2026-01-01 10:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of Vitamin P (CAS: 949926-49-2)?

Vitamin P (CAS: 949926-49-2) is a crystalline compound with a molecular weight of approximately 450....

Compound Q&A

What industries use Vitamin P (CAS: 949926-49-2)?

Vitamin P (CAS: 949926-49-2) is used in the pharmaceutical industry for its potential health benefit...

Compound Q&A

What precautions should be taken when handling Vitamin P (CAS: 949926-49-2)?

When handling Vitamin P (CAS: 949926-49-2), it is essential to wear personal protective equipment (P...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...