Compound Q&A

What industries use (2,4-Dichloro-5-isopropoxyphenyl)hydazine (CAS: 40178-22-1)?

Answer

(2,4-Dichloro-5-isopropoxyphenyl)hydrazine
(2,4-Dichloro-5-isopropoxyphenyl)hydazine is primarily used as an intermediate in the pharmaceutical and fine chemical industries. It serves as a key building block in the synthesis of various drug candidates and active pharmaceutical ingredients. Additionally, it may find applications in the polymer and semiconductor industries, although on a smaller scale compared to its pharmaceutical uses.

About

CAS No 40178-22-1
English Name (2,4-Dichloro-5-isopropoxyphenyl)hydrazine
Molecular Formula C9H12Cl2N2O
Molecular Weight 235.11 g/mol
SMILES CC(C)OC1=C(C=C(C(=C1)NN)Cl)Cl
InChIKey GWHQKTAGVTYTJX-UHFFFAOYSA-N
Last Updated: 2026-01-01 10:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2,4-Dichloro-5-isopropoxyphenyl)hydazine (CAS: 40178-22-1)?

(2,4-Dichloro-5-isopropoxyphenyl)hydazine is a crystalline solid with a molecular weight of approxim...

Compound Q&A

How is (2,4-Dichloro-5-isopropoxyphenyl)hydazine (CAS: 40178-22-1) typically synthesized?

(2,4-Dichloro-5-isopropoxyphenyl)hydazine can be synthesized via the reduction of the corresponding ...

Compound Q&A

What precautions should be taken when handling (2,4-Dichloro-5-isopropoxyphenyl)hydazine (CAS: 40178-22-1)?

When handling (2,4-Dichloro-5-isopropoxyphenyl)hydazine, it is essential to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...