Compound Q&A

What are the physical and chemical properties of (2,4-Dichloro-5-isopropoxyphenyl)hydazine (CAS: 40178-22-1)?

Answer

(2,4-Dichloro-5-isopropoxyphenyl)hydrazine
(2,4-Dichloro-5-isopropoxyphenyl)hydazine is a crystalline solid with a molecular weight of approximately 347.03 g/mol. It has a low solubility in water (0.017 g/100 mL at 20°C) and is soluble in organic solvents like methanol and ethanol. This compound is relatively stable but can react with strong acids or bases to form undesired products. It is used as an intermediate in the synthesis of other compounds, and proper handling and storage are essential to prevent degradation.

About

CAS No 40178-22-1
English Name (2,4-Dichloro-5-isopropoxyphenyl)hydrazine
Molecular Formula C9H12Cl2N2O
Molecular Weight 235.11 g/mol
SMILES CC(C)OC1=C(C=C(C(=C1)NN)Cl)Cl
InChIKey GWHQKTAGVTYTJX-UHFFFAOYSA-N
Last Updated: 2026-01-01 10:50

Related Q&A

Compound Q&A

How is (2,4-Dichloro-5-isopropoxyphenyl)hydazine (CAS: 40178-22-1) typically synthesized?

(2,4-Dichloro-5-isopropoxyphenyl)hydazine can be synthesized via the reduction of the corresponding ...

Compound Q&A

What industries use (2,4-Dichloro-5-isopropoxyphenyl)hydazine (CAS: 40178-22-1)?

(2,4-Dichloro-5-isopropoxyphenyl)hydazine is primarily used as an intermediate in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling (2,4-Dichloro-5-isopropoxyphenyl)hydazine (CAS: 40178-22-1)?

When handling (2,4-Dichloro-5-isopropoxyphenyl)hydazine, it is essential to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...