Compound Q&A

What industries use 12-Sulfoabieta-8(14),9(11),12-trien-18-oic acid (CAS: 33159-27-2)?

Answer

12-Sulfoabieta-8(14),9(11),12-trien-18-oic acid
12-Sulfoabieta-8(14),9(11),12-trien-18-oic acid (CAS: 33159-27-2) is used in the pharmaceutical industry for the synthesis of bioactive molecules. It is also utilized in the polymer industry for developing functionalized polymers and in the semiconductor industry for creating sensing materials and devices. Additionally, it finds applications in the production of specialized surfactants and detergents.

About

CAS No 33159-27-2
English Name 12-Sulfoabieta-8(14),9(11),12-trien-18-oic acid
Molecular Formula C20H28O5S
Molecular Weight 380.51 g/mol
SMILES CC(C)C1=C(C=C2C(=C1)CCC3C2(CCCC3(C)C(=O)O)C)S(=O)(=O)O
InChIKey IWCWQNVIUXZOMJ-MISYRCLQSA-N
Last Updated: 2026-01-01 06:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 12-Sulfoabieta-8(14),9(11),12-trien-18-oic acid (CAS: 33159-27-2)?

12-Sulfoabieta-8(14),9(11),12-trien-18-oic acid (CAS: 33159-27-2) is a white to off-white crystallin...

Compound Q&A

How is 12-Sulfoabieta-8(14),9(11),12-trien-18-oic acid (CAS: 33159-27-2) typically synthesized?

12-Sulfoabieta-8(14),9(11),12-trien-18-oic acid is typically synthesized via a multi-step process in...

Compound Q&A

What precautions should be taken when handling 12-Sulfoabieta-8(14),9(11),12-trien-18-oic acid (CAS: 33159-27-2)?

When handling 12-Sulfoabieta-8(14),9(11),12-trien-18-oic acid (CAS: 33159-27-2), ensure the use of p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...