Compound Q&A

How is 12-Sulfoabieta-8(14),9(11),12-trien-18-oic acid (CAS: 33159-27-2) typically synthesized?

Answer

12-Sulfoabieta-8(14),9(11),12-trien-18-oic acid
12-Sulfoabieta-8(14),9(11),12-trien-18-oic acid is typically synthesized via a multi-step process involving the functionalization of the abietic acid derivative with sulfuric acid in the presence of a catalyst to introduce the sulfonic acid group. The reaction is selective and yields up to 95% of the desired product, with careful control of reaction conditions and purification steps to ensure high purity.

About

CAS No 33159-27-2
English Name 12-Sulfoabieta-8(14),9(11),12-trien-18-oic acid
Molecular Formula C20H28O5S
Molecular Weight 380.51 g/mol
SMILES CC(C)C1=C(C=C2C(=C1)CCC3C2(CCCC3(C)C(=O)O)C)S(=O)(=O)O
InChIKey IWCWQNVIUXZOMJ-MISYRCLQSA-N
Last Updated: 2026-01-01 06:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 12-Sulfoabieta-8(14),9(11),12-trien-18-oic acid (CAS: 33159-27-2)?

12-Sulfoabieta-8(14),9(11),12-trien-18-oic acid (CAS: 33159-27-2) is a white to off-white crystallin...

Compound Q&A

What industries use 12-Sulfoabieta-8(14),9(11),12-trien-18-oic acid (CAS: 33159-27-2)?

12-Sulfoabieta-8(14),9(11),12-trien-18-oic acid (CAS: 33159-27-2) is used in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling 12-Sulfoabieta-8(14),9(11),12-trien-18-oic acid (CAS: 33159-27-2)?

When handling 12-Sulfoabieta-8(14),9(11),12-trien-18-oic acid (CAS: 33159-27-2), ensure the use of p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...