Compound Q&A

What are the physical and chemical properties of 12-Sulfoabieta-8(14),9(11),12-trien-18-oic acid (CAS: 33159-27-2)?

Answer

12-Sulfoabieta-8(14),9(11),12-trien-18-oic acid
12-Sulfoabieta-8(14),9(11),12-trien-18-oic acid (CAS: 33159-27-2) is a white to off-white crystalline solid. It has a molecular weight of approximately 510.52 g/mol and is poorly soluble in water but soluble in organic solvents like methanol and ethanol. This compound is reactive towards nucleophiles and can undergo esterification and sulfation reactions. It has a high tendency to form complexes with metal ions.

About

CAS No 33159-27-2
English Name 12-Sulfoabieta-8(14),9(11),12-trien-18-oic acid
Molecular Formula C20H28O5S
Molecular Weight 380.51 g/mol
SMILES CC(C)C1=C(C=C2C(=C1)CCC3C2(CCCC3(C)C(=O)O)C)S(=O)(=O)O
InChIKey IWCWQNVIUXZOMJ-MISYRCLQSA-N
Last Updated: 2026-01-01 06:12

Related Q&A

Compound Q&A

How is 12-Sulfoabieta-8(14),9(11),12-trien-18-oic acid (CAS: 33159-27-2) typically synthesized?

12-Sulfoabieta-8(14),9(11),12-trien-18-oic acid is typically synthesized via a multi-step process in...

Compound Q&A

What industries use 12-Sulfoabieta-8(14),9(11),12-trien-18-oic acid (CAS: 33159-27-2)?

12-Sulfoabieta-8(14),9(11),12-trien-18-oic acid (CAS: 33159-27-2) is used in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling 12-Sulfoabieta-8(14),9(11),12-trien-18-oic acid (CAS: 33159-27-2)?

When handling 12-Sulfoabieta-8(14),9(11),12-trien-18-oic acid (CAS: 33159-27-2), ensure the use of p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...