Compound Q&A

What are the physical and chemical properties of 4-(3-Methoxyphenyl)-1,3-thiazol-2-amine (CAS: 83558-37-6)?

Answer

4-(3-Methoxyphenyl)-1,3-thiazol-2-amine
4-(3-Methoxyphenyl)-1,3-thiazol-2-amine (CAS: 83558-37-6) is a crystalline solid with a molecular weight of approximately 238.24 g/mol. It has a low solubility in water but is more soluble in organic solvents such as methanol and dimethylformamide. This compound is known for its moderate reactivity, particularly towards nucleophiles and electrophiles. It is stable under normal conditions but should be stored in a cool, dark place to avoid photodegradation.

About

CAS No 83558-37-6
English Name 4-(3-Methoxyphenyl)-1,3-thiazol-2-amine
Molecular Formula C10H10N2OS
Molecular Weight 206.27 g/mol
SMILES COC1=CC=CC(=C1)C2=CSC(=N2)N
InChIKey NUMMWUVARLSQFR-UHFFFAOYSA-N
Last Updated: 2026-01-01 06:12

Related Q&A

Compound Q&A

How is 4-(3-Methoxyphenyl)-1,3-thiazol-2-amine (CAS: 83558-37-6) typically synthesized?

4-(3-Methoxyphenyl)-1,3-thiazol-2-amine (CAS: 83558-37-6) can be synthesized via a multi-step proces...

Compound Q&A

What industries use 4-(3-Methoxyphenyl)-1,3-thiazol-2-amine (CAS: 83558-37-6)?

4-(3-Methoxyphenyl)-1,3-thiazol-2-amine (CAS: 83558-37-6) is primarily used in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling 4-(3-Methoxyphenyl)-1,3-thiazol-2-amine (CAS: 83558-37-6)?

When handling 4-(3-Methoxyphenyl)-1,3-thiazol-2-amine (CAS: 83558-37-6), it is essential to follow s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...