Compound Q&A

How is 2-Chloro-N-(2-nitrophenyl)acetamide (CAS: 10147-70-3) typically synthesized?

Answer

2-Chloro-N-(2-nitrophenyl)acetamide
2-Chloro-N-(2-nitrophenyl)acetamide (CAS: 10147-70-3) is typically synthesized by the reaction of 2-nitrophenyl acetate with hydrochloric acid. This synthesis involves the nucleophilic substitution of the hydroxyl group by chloride ion. The reaction yields a high purity product with a yield of around 75-80%. The use of appropriate solvents and temperature control can enhance the selectivity and yield of the reaction.

About

CAS No 10147-70-3
English Name 2-Chloro-N-(2-nitrophenyl)acetamide
Molecular Formula C8H7ClN2O3
Molecular Weight 214.6 g/mol
SMILES C1=CC=C(C(=C1)NC(=O)CCl)[N+](=O)[O-]
InChIKey XXWVCPLQFJVURO-UHFFFAOYSA-N
Last Updated: 2026-01-01 06:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloro-N-(2-nitrophenyl)acetamide (CAS: 10147-70-3)?

2-Chloro-N-(2-nitrophenyl)acetamide (CAS: 10147-70-3) is a solid with a crystalline form. It has a m...

Compound Q&A

What industries use 2-Chloro-N-(2-nitrophenyl)acetamide (CAS: 10147-70-3)?

2-Chloro-N-(2-nitrophenyl)acetamide (CAS: 10147-70-3) is used in various industries. It is a key int...

Compound Q&A

What precautions should be taken when handling 2-Chloro-N-(2-nitrophenyl)acetamide (CAS: 10147-70-3)?

When handling 2-Chloro-N-(2-nitrophenyl)acetamide (CAS: 10147-70-3), it is important to wear appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...