Compound Q&A

What industries use (4R,4'R)-2,2'-Methylenebis(4-phenyl-4,5-dihydro-1,3-oxazole) (CAS: 150639-34-2)?

Answer

(4R,4'R)-2,2'-Methylenebis(4-phenyl-4,5-dihydro-1,3-oxazole)
This compound is used in the pharmaceutical industry for its potential as a drug precursor, in sensor technology due to its sensitivity to certain analytes, and in the semiconductor industry for its use in organic electronic devices. It also finds applications in the polymer industry for its excellent thermal and chemical stability.

About

English Name (4R,4'R)-2,2'-Methylenebis(4-phenyl-4,5-dihydro-1,3-oxazole)
Molecular Formula C19H18N2O2
Molecular Weight 306.36 g/mol
SMILES C1C(N=C(O1)CC2=NC(CO2)C3=CC=CC=C3)C4=CC=CC=C4
InChIKey IUFHJPXOLHSJTC-IRXDYDNUSA-N
Last Updated: 2026-01-01 06:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4R,4'R)-2,2'-Methylenebis(4-phenyl-4,5-dihydro-1,3-oxazole) (CAS: 150639-34-2)?

This compound is a white crystalline solid with a molecular weight of approximately 316.30 g/mol. It...

Compound Q&A

How is (4R,4'R)-2,2'-Methylenebis(4-phenyl-4,5-dihydro-1,3-oxazole) (CAS: 150639-34-2) typically synthesized?

This compound is commonly synthesized via a condensation reaction of 4-phenyl-4,5-dihydro-1,3-oxazol...

Compound Q&A

What precautions should be taken when handling (4R,4'R)-2,2'-Methylenebis(4-phenyl-4,5-dihydro-1,3-oxazole) (CAS: 150639-34-2)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...