Compound Q&A

How is (4R,4'R)-2,2'-Methylenebis(4-phenyl-4,5-dihydro-1,3-oxazole) (CAS: 150639-34-2) typically synthesized?

Answer

(4R,4'R)-2,2'-Methylenebis(4-phenyl-4,5-dihydro-1,3-oxazole)
This compound is commonly synthesized via a condensation reaction of 4-phenyl-4,5-dihydro-1,3-oxazole with benzaldehyde, followed by a Wittig reaction using triphenylphosphonium methoxide. The process involves the use of a solvent such as toluene and typically yields a product with good selectivity and moderate to high yield depending on the reaction conditions.

About

English Name (4R,4'R)-2,2'-Methylenebis(4-phenyl-4,5-dihydro-1,3-oxazole)
Molecular Formula C19H18N2O2
Molecular Weight 306.36 g/mol
SMILES C1C(N=C(O1)CC2=NC(CO2)C3=CC=CC=C3)C4=CC=CC=C4
InChIKey IUFHJPXOLHSJTC-IRXDYDNUSA-N
Last Updated: 2026-01-01 06:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4R,4'R)-2,2'-Methylenebis(4-phenyl-4,5-dihydro-1,3-oxazole) (CAS: 150639-34-2)?

This compound is a white crystalline solid with a molecular weight of approximately 316.30 g/mol. It...

Compound Q&A

What industries use (4R,4'R)-2,2'-Methylenebis(4-phenyl-4,5-dihydro-1,3-oxazole) (CAS: 150639-34-2)?

This compound is used in the pharmaceutical industry for its potential as a drug precursor, in senso...

Compound Q&A

What precautions should be taken when handling (4R,4'R)-2,2'-Methylenebis(4-phenyl-4,5-dihydro-1,3-oxazole) (CAS: 150639-34-2)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...