Compound Q&A

What precautions should be taken when handling 3-(2-Methyl-4-pyrimidinyl)benzenesulfonyl chloride (CAS: 465514-07-2)?

Answer

3-(2-Methyl-4-pyrimidinyl)benzenesulfonyl chloride
When handling 3-(2-Methyl-4-pyrimidinyl)benzenesulfonyl chloride, it is essential to wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. This compound should be used in a well-ventilated area or a fume hood to prevent inhalation. Spills should be cleaned up with caution, and the material safety data sheet (MSDS) should be consulted for specific cleanup procedures. Handling should be performed according to standard safety protocols to avoid skin and eye contact.

About

English Name 3-(2-Methyl-4-pyrimidinyl)benzenesulfonyl chloride
Molecular Formula C11H9ClN2O2S
Molecular Weight 268.72 g/mol
SMILES CC1=NC=CC(=N1)C2=CC(=CC=C2)S(=O)(=O)Cl
InChIKey ZLLPUDLQNCNHFM-UHFFFAOYSA-N
Last Updated: 2026-01-01 06:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(2-Methyl-4-pyrimidinyl)benzenesulfonyl chloride (CAS: 465514-07-2)?

3-(2-Methyl-4-pyrimidinyl)benzenesulfonyl chloride is a crystalline compound with a molecular weight...

Compound Q&A

How is 3-(2-Methyl-4-pyrimidinyl)benzenesulfonyl chloride (CAS: 465514-07-2) typically synthesized?

3-(2-Methyl-4-pyrimidinyl)benzenesulfonyl chloride can be synthesized via a multi-step process invol...

Compound Q&A

What industries use 3-(2-Methyl-4-pyrimidinyl)benzenesulfonyl chloride (CAS: 465514-07-2)?

3-(2-Methyl-4-pyrimidinyl)benzenesulfonyl chloride finds applications in the pharmaceutical industry...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...