Compound Q&A

What industries use 3-(2-Methyl-4-pyrimidinyl)benzenesulfonyl chloride (CAS: 465514-07-2)?

Answer

3-(2-Methyl-4-pyrimidinyl)benzenesulfonyl chloride
3-(2-Methyl-4-pyrimidinyl)benzenesulfonyl chloride finds applications in the pharmaceutical industry for its role as an intermediate in drug synthesis. It is also used in the polymer industry for its potential in developing new polymer materials with specific properties. Additionally, it has applications in semiconductors and sensors due to its unique chemical structure.

About

English Name 3-(2-Methyl-4-pyrimidinyl)benzenesulfonyl chloride
Molecular Formula C11H9ClN2O2S
Molecular Weight 268.72 g/mol
SMILES CC1=NC=CC(=N1)C2=CC(=CC=C2)S(=O)(=O)Cl
InChIKey ZLLPUDLQNCNHFM-UHFFFAOYSA-N
Last Updated: 2026-01-01 06:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(2-Methyl-4-pyrimidinyl)benzenesulfonyl chloride (CAS: 465514-07-2)?

3-(2-Methyl-4-pyrimidinyl)benzenesulfonyl chloride is a crystalline compound with a molecular weight...

Compound Q&A

How is 3-(2-Methyl-4-pyrimidinyl)benzenesulfonyl chloride (CAS: 465514-07-2) typically synthesized?

3-(2-Methyl-4-pyrimidinyl)benzenesulfonyl chloride can be synthesized via a multi-step process invol...

Compound Q&A

What precautions should be taken when handling 3-(2-Methyl-4-pyrimidinyl)benzenesulfonyl chloride (CAS: 465514-07-2)?

When handling 3-(2-Methyl-4-pyrimidinyl)benzenesulfonyl chloride, it is essential to wear appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...