Compound Q&A

How is 3-(2-Methyl-4-pyrimidinyl)benzenesulfonyl chloride (CAS: 465514-07-2) typically synthesized?

Answer

3-(2-Methyl-4-pyrimidinyl)benzenesulfonyl chloride
3-(2-Methyl-4-pyrimidinyl)benzenesulfonyl chloride can be synthesized via a multi-step process involving the condensation of 2-methylpyrimidin-4-amine with benzenesulfonyl chloride. The reaction is typically conducted in the presence of a suitable base like triethylamine, and the product is isolated by recrystallization. This compound is often prepared using reagents and conditions that ensure high selectivity and good yield.

About

English Name 3-(2-Methyl-4-pyrimidinyl)benzenesulfonyl chloride
Molecular Formula C11H9ClN2O2S
Molecular Weight 268.72 g/mol
SMILES CC1=NC=CC(=N1)C2=CC(=CC=C2)S(=O)(=O)Cl
InChIKey ZLLPUDLQNCNHFM-UHFFFAOYSA-N
Last Updated: 2026-01-01 06:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(2-Methyl-4-pyrimidinyl)benzenesulfonyl chloride (CAS: 465514-07-2)?

3-(2-Methyl-4-pyrimidinyl)benzenesulfonyl chloride is a crystalline compound with a molecular weight...

Compound Q&A

What industries use 3-(2-Methyl-4-pyrimidinyl)benzenesulfonyl chloride (CAS: 465514-07-2)?

3-(2-Methyl-4-pyrimidinyl)benzenesulfonyl chloride finds applications in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling 3-(2-Methyl-4-pyrimidinyl)benzenesulfonyl chloride (CAS: 465514-07-2)?

When handling 3-(2-Methyl-4-pyrimidinyl)benzenesulfonyl chloride, it is essential to wear appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...