Compound Q&A

What industries use Rizatriptan n10-oxide (CAS: 260435-42-5)?

Answer

Rizatriptan n10-oxide
Rizatriptan n10-oxide is primarily used in the pharmaceutical industry. It is a key intermediate in the synthesis of rizatriptan, a drug used to treat migraine headaches. Additionally, it may have applications in polymer science and materials science, particularly in the development of new drug delivery systems and sensors.

About

English Name Rizatriptan n10-oxide
Molecular Formula C15H19N5O
Molecular Weight 285.34 g/mol
SMILES C[N+](C)(CCC1=CNC2=C1C=C(C=C2)CN3C=NC=N3)[O-]
InChIKey DQTBNOJGXNZYDG-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Rizatriptan n10-oxide (CAS: 260435-42-5)?

Rizatriptan n10-oxide has a crystalline form with a melting point around 198-200°C. Its molecular we...

Compound Q&A

How is Rizatriptan n10-oxide (CAS: 260435-42-5) typically synthesized?

Rizatriptan n10-oxide is synthesized by the oxidation of rizatriptan using a suitable oxidizing agen...

Compound Q&A

What precautions should be taken when handling Rizatriptan n10-oxide (CAS: 260435-42-5)?

When handling Rizatriptan n10-oxide, it is essential to wear appropriate personal protective equipme...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...