Compound Q&A

How is Rizatriptan n10-oxide (CAS: 260435-42-5) typically synthesized?

Answer

Rizatriptan n10-oxide
Rizatriptan n10-oxide is synthesized by the oxidation of rizatriptan using a suitable oxidizing agent like potassium permanganate in the presence of a suitable solvent like dimethylformamide (DMF). The reaction is carried out under controlled conditions to ensure high selectivity and yield. The product's purity is improved through recrystallization, and it is typically obtained as a white solid.

About

English Name Rizatriptan n10-oxide
Molecular Formula C15H19N5O
Molecular Weight 285.34 g/mol
SMILES C[N+](C)(CCC1=CNC2=C1C=C(C=C2)CN3C=NC=N3)[O-]
InChIKey DQTBNOJGXNZYDG-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Rizatriptan n10-oxide (CAS: 260435-42-5)?

Rizatriptan n10-oxide has a crystalline form with a melting point around 198-200°C. Its molecular we...

Compound Q&A

What industries use Rizatriptan n10-oxide (CAS: 260435-42-5)?

Rizatriptan n10-oxide is primarily used in the pharmaceutical industry. It is a key intermediate in ...

Compound Q&A

What precautions should be taken when handling Rizatriptan n10-oxide (CAS: 260435-42-5)?

When handling Rizatriptan n10-oxide, it is essential to wear appropriate personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...