Compound Q&A

What are the physical and chemical properties of Rizatriptan n10-oxide (CAS: 260435-42-5)?

Answer

Rizatriptan n10-oxide
Rizatriptan n10-oxide has a crystalline form with a melting point around 198-200°C. Its molecular weight is approximately 389.47 g/mol. It is slightly soluble in water and ethanol. Chemically, it is relatively stable but can react with strong acids and bases. It is a white or off-white solid with poor solubility in common organic solvents.

About

English Name Rizatriptan n10-oxide
Molecular Formula C15H19N5O
Molecular Weight 285.34 g/mol
SMILES C[N+](C)(CCC1=CNC2=C1C=C(C=C2)CN3C=NC=N3)[O-]
InChIKey DQTBNOJGXNZYDG-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

How is Rizatriptan n10-oxide (CAS: 260435-42-5) typically synthesized?

Rizatriptan n10-oxide is synthesized by the oxidation of rizatriptan using a suitable oxidizing agen...

Compound Q&A

What industries use Rizatriptan n10-oxide (CAS: 260435-42-5)?

Rizatriptan n10-oxide is primarily used in the pharmaceutical industry. It is a key intermediate in ...

Compound Q&A

What precautions should be taken when handling Rizatriptan n10-oxide (CAS: 260435-42-5)?

When handling Rizatriptan n10-oxide, it is essential to wear appropriate personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...