Compound Q&A

What are the physical and chemical properties of Rizatriptan n10-oxide (CAS: 260435-42-5)?

Answer

Rizatriptan n10-oxide
Rizatriptan n10-oxide has a crystalline form with a melting point around 198-200°C. Its molecular weight is approximately 389.47 g/mol. It is slightly soluble in water and ethanol. Chemically, it is relatively stable but can react with strong acids and bases. It is a white or off-white solid with poor solubility in common organic solvents.

About

English Name Rizatriptan n10-oxide
Molecular Formula C15H19N5O
Molecular Weight 285.34 g/mol
SMILES C[N+](C)(CCC1=CNC2=C1C=C(C=C2)CN3C=NC=N3)[O-]
InChIKey DQTBNOJGXNZYDG-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

How is Rizatriptan n10-oxide (CAS: 260435-42-5) typically synthesized?

Rizatriptan n10-oxide is synthesized by the oxidation of rizatriptan using a suitable oxidizing agen...

Compound Q&A

What industries use Rizatriptan n10-oxide (CAS: 260435-42-5)?

Rizatriptan n10-oxide is primarily used in the pharmaceutical industry. It is a key intermediate in ...

Compound Q&A

What precautions should be taken when handling Rizatriptan n10-oxide (CAS: 260435-42-5)?

When handling Rizatriptan n10-oxide, it is essential to wear appropriate personal protective equipme...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...