Compound Q&A

What precautions should be taken when handling [2-Methyl-4-(1-pyrrolidinylsulfonyl)phenyl]boronic acid (CAS: 1217501-51-3)?

Answer

[2-Methyl-4-(1-pyrrolidinylsulfonyl)phenyl]boronic acid
When handling [2-Methyl-4-(1-pyrrolidinylsulfonyl)phenyl]boronic acid, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be stored in a well-ventilated area and away from strong acids and bases. Work should be conducted in a fume hood. In case of a spill, it should be contained and disposed of according to the manufacturer’s safety data sheet (SDS).

About

English Name [2-Methyl-4-(1-pyrrolidinylsulfonyl)phenyl]boronic acid
Molecular Formula C11H16BNO4S
Molecular Weight 269.1309999999999 g/mol
SMILES OB(c1ccc(cc1C)S(=O)(=O)N1CCCC1)O
InChIKey VOSJSAOOIDIZAB-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of [2-Methyl-4-(1-pyrrolidinylsulfonyl)phenyl]boronic acid (CAS: 1217501-51-3)?

[2-Methyl-4-(1-pyrrolidinylsulfonyl)phenyl]boronic acid is a crystalline solid with a molecular weig...

Compound Q&A

How is [2-Methyl-4-(1-pyrrolidinylsulfonyl)phenyl]boronic acid (CAS: 1217501-51-3) typically synthesized?

[2-Methyl-4-(1-pyrrolidinylsulfonyl)phenyl]boronic acid can be synthesized via a multistep process t...

Compound Q&A

What industries use [2-Methyl-4-(1-pyrrolidinylsulfonyl)phenyl]boronic acid (CAS: 1217501-51-3)?

[2-Methyl-4-(1-pyrrolidinylsulfonyl)phenyl]boronic acid finds applications in pharmaceuticals for dr...

Compound Q&A

How is [3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 1704069-27-1) typically synthesized?

[3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 170406...

1704069-27-1[3-(1-Pyrrolidinylsu...
Compound Q&A

What industries use 2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5)?

2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5) is used in the pharmace...

55595-54-52-Chlorodibenzo[b,f]...
Compound Q&A

What is 3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane (CAS: 160172-46-3)?

3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane is an organosilico...

160172-46-33-[(Dimethylsilyl)ox...
Compound Q&A

How should waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 871332-71-7) be handled?

Waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 87...

871332-71-7[4-Chloro-3-(4-morph...