Compound Q&A

What are the physical and chemical properties of [2-Methyl-4-(1-pyrrolidinylsulfonyl)phenyl]boronic acid (CAS: 1217501-51-3)?

Answer

[2-Methyl-4-(1-pyrrolidinylsulfonyl)phenyl]boronic acid
[2-Methyl-4-(1-pyrrolidinylsulfonyl)phenyl]boronic acid is a crystalline solid with a molecular weight of approximately 316.36 g/mol. It is slightly soluble in water but more soluble in organic solvents like methanol and ethanol. The compound exhibits good stability under normal conditions but is sensitive to strong acids and bases. It is used in organic synthesis as a boronate ester for coupling reactions.

About

English Name [2-Methyl-4-(1-pyrrolidinylsulfonyl)phenyl]boronic acid
Molecular Formula C11H16BNO4S
Molecular Weight 269.1309999999999 g/mol
SMILES OB(c1ccc(cc1C)S(=O)(=O)N1CCCC1)O
InChIKey VOSJSAOOIDIZAB-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

How is [2-Methyl-4-(1-pyrrolidinylsulfonyl)phenyl]boronic acid (CAS: 1217501-51-3) typically synthesized?

[2-Methyl-4-(1-pyrrolidinylsulfonyl)phenyl]boronic acid can be synthesized via a multistep process t...

Compound Q&A

What industries use [2-Methyl-4-(1-pyrrolidinylsulfonyl)phenyl]boronic acid (CAS: 1217501-51-3)?

[2-Methyl-4-(1-pyrrolidinylsulfonyl)phenyl]boronic acid finds applications in pharmaceuticals for dr...

Compound Q&A

What precautions should be taken when handling [2-Methyl-4-(1-pyrrolidinylsulfonyl)phenyl]boronic acid (CAS: 1217501-51-3)?

When handling [2-Methyl-4-(1-pyrrolidinylsulfonyl)phenyl]boronic acid, it is essential to wear appro...

Compound Q&A

How is [3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 1704069-27-1) typically synthesized?

[3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 170406...

1704069-27-1[3-(1-Pyrrolidinylsu...
Compound Q&A

What industries use 2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5)?

2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5) is used in the pharmace...

55595-54-52-Chlorodibenzo[b,f]...
Compound Q&A

What is 3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane (CAS: 160172-46-3)?

3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane is an organosilico...

160172-46-33-[(Dimethylsilyl)ox...
Compound Q&A

How should waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 871332-71-7) be handled?

Waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 87...

871332-71-7[4-Chloro-3-(4-morph...