Compound Q&A

What industries use [2-Methyl-4-(1-pyrrolidinylsulfonyl)phenyl]boronic acid (CAS: 1217501-51-3)?

Answer

[2-Methyl-4-(1-pyrrolidinylsulfonyl)phenyl]boronic acid
[2-Methyl-4-(1-pyrrolidinylsulfonyl)phenyl]boronic acid finds applications in pharmaceuticals for drug discovery and synthesis, as well as in the synthesis of various organic compounds. It is used in the preparation of boronate esters, which are crucial intermediates in organic synthesis and are also applied in the development of sensors and semiconductors.

About

English Name [2-Methyl-4-(1-pyrrolidinylsulfonyl)phenyl]boronic acid
Molecular Formula C11H16BNO4S
Molecular Weight 269.1309999999999 g/mol
SMILES OB(c1ccc(cc1C)S(=O)(=O)N1CCCC1)O
InChIKey VOSJSAOOIDIZAB-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of [2-Methyl-4-(1-pyrrolidinylsulfonyl)phenyl]boronic acid (CAS: 1217501-51-3)?

[2-Methyl-4-(1-pyrrolidinylsulfonyl)phenyl]boronic acid is a crystalline solid with a molecular weig...

Compound Q&A

How is [2-Methyl-4-(1-pyrrolidinylsulfonyl)phenyl]boronic acid (CAS: 1217501-51-3) typically synthesized?

[2-Methyl-4-(1-pyrrolidinylsulfonyl)phenyl]boronic acid can be synthesized via a multistep process t...

Compound Q&A

What precautions should be taken when handling [2-Methyl-4-(1-pyrrolidinylsulfonyl)phenyl]boronic acid (CAS: 1217501-51-3)?

When handling [2-Methyl-4-(1-pyrrolidinylsulfonyl)phenyl]boronic acid, it is essential to wear appro...

Compound Q&A

How is [3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 1704069-27-1) typically synthesized?

[3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 170406...

1704069-27-1[3-(1-Pyrrolidinylsu...
Compound Q&A

What industries use 2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5)?

2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5) is used in the pharmace...

55595-54-52-Chlorodibenzo[b,f]...
Compound Q&A

What is 3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane (CAS: 160172-46-3)?

3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane is an organosilico...

160172-46-33-[(Dimethylsilyl)ox...
Compound Q&A

How should waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 871332-71-7) be handled?

Waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 87...

871332-71-7[4-Chloro-3-(4-morph...