Compound Q&A

What industries use Methyl 3-bromo-4-isopropylbenzoate (CAS: 318528-55-1)?

Answer

Methyl 3-bromo-4-isopropylbenzoate
Methyl 3-bromo-4-isopropylbenzoate is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It is also utilized in the polymer industry for the production of certain polymers. Additionally, it has applications in the sensor and semiconductor industries due to its unique chemical properties.

About

English Name Methyl 3-bromo-4-isopropylbenzoate
Molecular Formula C11H13BrO2
Molecular Weight 257.13 g/mol
SMILES O=C(OC)C1=CC=C(C(C)C)C(Br)=C1
InChIKey KVBRRJZVELPSOL-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 3-bromo-4-isopropylbenzoate (CAS: 318528-55-1)?

Methyl 3-bromo-4-isopropylbenzoate is a crystalline compound with a molecular weight of approximatel...

Compound Q&A

How is Methyl 3-bromo-4-isopropylbenzoate (CAS: 318528-55-1) typically synthesized?

Methyl 3-bromo-4-isopropylbenzoate can be synthesized through bromination of 4-isopropylbenzoic acid...

Compound Q&A

What precautions should be taken when handling Methyl 3-bromo-4-isopropylbenzoate (CAS: 318528-55-1)?

When handling Methyl 3-bromo-4-isopropylbenzoate, it is essential to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...