Compound Q&A

What are the physical and chemical properties of Methyl 3-bromo-4-isopropylbenzoate (CAS: 318528-55-1)?

Answer

Methyl 3-bromo-4-isopropylbenzoate
Methyl 3-bromo-4-isopropylbenzoate is a crystalline compound with a molecular weight of approximately 277.04 g/mol. It has a low solubility in water but is soluble in organic solvents such as ethanol and chloroform. This compound is reactive, particularly towards nucleophiles, and can undergo electrophilic aromatic substitution reactions. It is commonly used as an intermediate in organic synthesis.

About

English Name Methyl 3-bromo-4-isopropylbenzoate
Molecular Formula C11H13BrO2
Molecular Weight 257.13 g/mol
SMILES O=C(OC)C1=CC=C(C(C)C)C(Br)=C1
InChIKey KVBRRJZVELPSOL-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

How is Methyl 3-bromo-4-isopropylbenzoate (CAS: 318528-55-1) typically synthesized?

Methyl 3-bromo-4-isopropylbenzoate can be synthesized through bromination of 4-isopropylbenzoic acid...

Compound Q&A

What industries use Methyl 3-bromo-4-isopropylbenzoate (CAS: 318528-55-1)?

Methyl 3-bromo-4-isopropylbenzoate is primarily used in the pharmaceutical industry as an intermedia...

Compound Q&A

What precautions should be taken when handling Methyl 3-bromo-4-isopropylbenzoate (CAS: 318528-55-1)?

When handling Methyl 3-bromo-4-isopropylbenzoate, it is essential to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...