Compound Q&A

How is Methyl 3-bromo-4-isopropylbenzoate (CAS: 318528-55-1) typically synthesized?

Answer

Methyl 3-bromo-4-isopropylbenzoate
Methyl 3-bromo-4-isopropylbenzoate can be synthesized through bromination of 4-isopropylbenzoic acid followed by esterification. The process involves reacting 4-isopropylbenzoic acid with bromine in the presence of a base such as sodium hydroxide or potassium hydroxide, and then treating the resulting bromobenzoic acid with methyl alcohol in the presence of an acid catalyst like sulfuric acid.

About

English Name Methyl 3-bromo-4-isopropylbenzoate
Molecular Formula C11H13BrO2
Molecular Weight 257.13 g/mol
SMILES O=C(OC)C1=CC=C(C(C)C)C(Br)=C1
InChIKey KVBRRJZVELPSOL-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 3-bromo-4-isopropylbenzoate (CAS: 318528-55-1)?

Methyl 3-bromo-4-isopropylbenzoate is a crystalline compound with a molecular weight of approximatel...

Compound Q&A

What industries use Methyl 3-bromo-4-isopropylbenzoate (CAS: 318528-55-1)?

Methyl 3-bromo-4-isopropylbenzoate is primarily used in the pharmaceutical industry as an intermedia...

Compound Q&A

What precautions should be taken when handling Methyl 3-bromo-4-isopropylbenzoate (CAS: 318528-55-1)?

When handling Methyl 3-bromo-4-isopropylbenzoate, it is essential to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...