Compound Q&A

What industries use (2S,5S)-1-benzyl-2,5-dimethylpiperazine dihydrochloride (CAS: 745031-35-0)?

Answer

(2S,5S)-1-benzyl-2,5-dimethylpiperazine dihydrochloride
This compound is widely used in the pharmaceutical industry for its potential in drug development, particularly in central nervous system research. It is also used in the polymer industry for its reactivity and in the production of sensors and semiconductors due to its electronic properties.

About

English Name (2S,5S)-1-benzyl-2,5-dimethylpiperazine dihydrochloride
Molecular Formula C13H22Cl2N2
Molecular Weight 277.23 g/mol
SMILES CC1CNC(CN1CC2=CC=CC=C2)C.Cl.Cl
InChIKey NNOPREOUOQQPDC-AQEKLAMFSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S,5S)-1-benzyl-2,5-dimethylpiperazine dihydrochloride (CAS: 745031-35-0)?

The compound (2S,5S)-1-benzyl-2,5-dimethylpiperazine dihydrochloride is a white crystalline solid. I...

Compound Q&A

How is (2S,5S)-1-benzyl-2,5-dimethylpiperazine dihydrochloride (CAS: 745031-35-0) typically synthesized?

The compound is typically synthesized via the reaction of benzylamine with dimethylamine followed by...

Compound Q&A

What precautions should be taken when handling (2S,5S)-1-benzyl-2,5-dimethylpiperazine dihydrochloride (CAS: 745031-35-0)?

When handling this compound, ensure to use personal protective equipment such as gloves, goggles, an...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...