Compound Q&A

How is (2S,5S)-1-benzyl-2,5-dimethylpiperazine dihydrochloride (CAS: 745031-35-0) typically synthesized?

Answer

(2S,5S)-1-benzyl-2,5-dimethylpiperazine dihydrochloride
The compound is typically synthesized via the reaction of benzylamine with dimethylamine followed by the chloride addition. The process involves the use of stoichiometric amounts of reagents and typically yields around 85-90% purity. The reaction is catalyzed by an appropriate base to ensure high selectivity and yield.

About

English Name (2S,5S)-1-benzyl-2,5-dimethylpiperazine dihydrochloride
Molecular Formula C13H22Cl2N2
Molecular Weight 277.23 g/mol
SMILES CC1CNC(CN1CC2=CC=CC=C2)C.Cl.Cl
InChIKey NNOPREOUOQQPDC-AQEKLAMFSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S,5S)-1-benzyl-2,5-dimethylpiperazine dihydrochloride (CAS: 745031-35-0)?

The compound (2S,5S)-1-benzyl-2,5-dimethylpiperazine dihydrochloride is a white crystalline solid. I...

Compound Q&A

What industries use (2S,5S)-1-benzyl-2,5-dimethylpiperazine dihydrochloride (CAS: 745031-35-0)?

This compound is widely used in the pharmaceutical industry for its potential in drug development, p...

Compound Q&A

What precautions should be taken when handling (2S,5S)-1-benzyl-2,5-dimethylpiperazine dihydrochloride (CAS: 745031-35-0)?

When handling this compound, ensure to use personal protective equipment such as gloves, goggles, an...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...