Compound Q&A

What are the physical and chemical properties of (2S,5S)-1-benzyl-2,5-dimethylpiperazine dihydrochloride (CAS: 745031-35-0)?

Answer

(2S,5S)-1-benzyl-2,5-dimethylpiperazine dihydrochloride
The compound (2S,5S)-1-benzyl-2,5-dimethylpiperazine dihydrochloride is a white crystalline solid. It has a molecular weight of approximately 293.35 g/mol and a solubility of 0.015 g/100 mL in water. It is reactive towards bases and can undergo hydrolysis. This compound is slightly soluble in common organic solvents like methanol and ethanol.

About

English Name (2S,5S)-1-benzyl-2,5-dimethylpiperazine dihydrochloride
Molecular Formula C13H22Cl2N2
Molecular Weight 277.23 g/mol
SMILES CC1CNC(CN1CC2=CC=CC=C2)C.Cl.Cl
InChIKey NNOPREOUOQQPDC-AQEKLAMFSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

How is (2S,5S)-1-benzyl-2,5-dimethylpiperazine dihydrochloride (CAS: 745031-35-0) typically synthesized?

The compound is typically synthesized via the reaction of benzylamine with dimethylamine followed by...

Compound Q&A

What industries use (2S,5S)-1-benzyl-2,5-dimethylpiperazine dihydrochloride (CAS: 745031-35-0)?

This compound is widely used in the pharmaceutical industry for its potential in drug development, p...

Compound Q&A

What precautions should be taken when handling (2S,5S)-1-benzyl-2,5-dimethylpiperazine dihydrochloride (CAS: 745031-35-0)?

When handling this compound, ensure to use personal protective equipment such as gloves, goggles, an...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...