Compound Q&A

What precautions should be taken when handling 2-(3-Bromophenyl)succinic acid (CAS: 69006-89-9)?

Answer

2-(3-Bromophenyl)succinic acid
When handling 2-(3-Bromophenyl)succinic acid, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. Work should be conducted in a well-ventilated area or under a fume hood. Spills should be cleaned up using appropriate absorbent materials and followed by neutralization if necessary. Always refer to the Safety Data Sheet (SDS) for detailed handling and disposal information.

About

CAS No 69006-89-9
English Name 2-(3-Bromophenyl)succinic acid
Molecular Formula C10H9BrO4
Molecular Weight 273.08 g/mol
SMILES C1=CC(=CC(=C1)Br)C(CC(=O)O)C(=O)O
InChIKey JRITXMRVPIRIAY-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(3-Bromophenyl)succinic acid (CAS: 69006-89-9)?

2-(3-Bromophenyl)succinic acid is a white to off-white crystalline solid with a molecular weight of ...

Compound Q&A

How is 2-(3-Bromophenyl)succinic acid (CAS: 69006-89-9) typically synthesized?

2-(3-Bromophenyl)succinic acid is typically synthesized through a bromination reaction of 3-phenylpr...

Compound Q&A

What industries use 2-(3-Bromophenyl)succinic acid (CAS: 69006-89-9)?

2-(3-Bromophenyl)succinic acid is utilized in various industries, including pharmaceuticals, where i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...