Compound Q&A

What industries use 2-(3-Bromophenyl)succinic acid (CAS: 69006-89-9)?

Answer

2-(3-Bromophenyl)succinic acid
2-(3-Bromophenyl)succinic acid is utilized in various industries, including pharmaceuticals, where it serves as a starting material for the synthesis of medicinal compounds. It is also used in the production of certain polymers and in sensor applications due to its chemical reactivity and functional groups.

About

CAS No 69006-89-9
English Name 2-(3-Bromophenyl)succinic acid
Molecular Formula C10H9BrO4
Molecular Weight 273.08 g/mol
SMILES C1=CC(=CC(=C1)Br)C(CC(=O)O)C(=O)O
InChIKey JRITXMRVPIRIAY-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(3-Bromophenyl)succinic acid (CAS: 69006-89-9)?

2-(3-Bromophenyl)succinic acid is a white to off-white crystalline solid with a molecular weight of ...

Compound Q&A

How is 2-(3-Bromophenyl)succinic acid (CAS: 69006-89-9) typically synthesized?

2-(3-Bromophenyl)succinic acid is typically synthesized through a bromination reaction of 3-phenylpr...

Compound Q&A

What precautions should be taken when handling 2-(3-Bromophenyl)succinic acid (CAS: 69006-89-9)?

When handling 2-(3-Bromophenyl)succinic acid, it is essential to wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...