Compound Q&A

What are the physical and chemical properties of 2-(3-Bromophenyl)succinic acid (CAS: 69006-89-9)?

Answer

2-(3-Bromophenyl)succinic acid
2-(3-Bromophenyl)succinic acid is a white to off-white crystalline solid with a molecular weight of approximately 261.03 g/mol. It is slightly soluble in water and soluble in organic solvents like ethanol and acetone. Chemically, it is reactive due to the presence of the bromine atom and carboxylic acid group, which can participate in various chemical reactions such as esterification and substitution reactions.

About

CAS No 69006-89-9
English Name 2-(3-Bromophenyl)succinic acid
Molecular Formula C10H9BrO4
Molecular Weight 273.08 g/mol
SMILES C1=CC(=CC(=C1)Br)C(CC(=O)O)C(=O)O
InChIKey JRITXMRVPIRIAY-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

How is 2-(3-Bromophenyl)succinic acid (CAS: 69006-89-9) typically synthesized?

2-(3-Bromophenyl)succinic acid is typically synthesized through a bromination reaction of 3-phenylpr...

Compound Q&A

What industries use 2-(3-Bromophenyl)succinic acid (CAS: 69006-89-9)?

2-(3-Bromophenyl)succinic acid is utilized in various industries, including pharmaceuticals, where i...

Compound Q&A

What precautions should be taken when handling 2-(3-Bromophenyl)succinic acid (CAS: 69006-89-9)?

When handling 2-(3-Bromophenyl)succinic acid, it is essential to wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...