Compound Q&A

What industries use 2-Methyl-2-propanyl 3-{2-[2-(2-propyn-1-yloxy)ethoxy]ethoxy}propanoate (CAS: 1374658-84-0)?

Answer

2-Methyl-2-propanyl 3-{2-[2-(2-propyn-1-yloxy)ethoxy]ethoxy}propanoate
2-Methyl-2-propanyl 3-{2-[2-(2-propyn-1-yloxy)ethoxy]ethoxy}propanoate is used in various industries, including pharmaceuticals, where it serves as a precursor for the synthesis of more complex molecules. It is also used in the polymer industry as a monomer for the production of advanced materials. In the semiconductor industry, it is used in the development of thin films and coatings. Additionally, it finds applications in sensor technology for detecting specific analytes.

About

English Name 2-Methyl-2-propanyl 3-{2-[2-(2-propyn-1-yloxy)ethoxy]ethoxy}propanoate
Molecular Formula C14H24O5
Molecular Weight 16.04 g/mol
SMILES C#CCOCCOCCOCCC(=O)OC(C)(C)C
InChIKey VNWKTOKETHGBQD-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 3-{2-[2-(2-propyn-1-yloxy)ethoxy]ethoxy}propanoate (CAS: 1374658-84-0)?

2-Methyl-2-propanyl 3-{2-[2-(2-propyn-1-yloxy)ethoxy]ethoxy}propanoate has a crystalline form. Its m...

Compound Q&A

How is 2-Methyl-2-propanyl 3-{2-[2-(2-propyn-1-yloxy)ethoxy]ethoxy}propanoate (CAS: 1374658-84-0) typically synthesized?

2-Methyl-2-propanyl 3-{2-[2-(2-propyn-1-yloxy)ethoxy]ethoxy}propanoate is typically synthesized usin...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 3-{2-[2-(2-propyn-1-yloxy)ethoxy]ethoxy}propanoate (CAS: 1374658-84-0)?

When handling 2-Methyl-2-propanyl 3-{2-[2-(2-propyn-1-yloxy)ethoxy]ethoxy}propanoate, it is importan...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...