Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 3-{2-[2-(2-propyn-1-yloxy)ethoxy]ethoxy}propanoate (CAS: 1374658-84-0)?

Answer

2-Methyl-2-propanyl 3-{2-[2-(2-propyn-1-yloxy)ethoxy]ethoxy}propanoate
2-Methyl-2-propanyl 3-{2-[2-(2-propyn-1-yloxy)ethoxy]ethoxy}propanoate has a crystalline form. Its molecular weight is approximately 440.46 g/mol. It has a low solubility in water but is soluble in organic solvents. The compound is reactive towards nucleophiles and can undergo substitution reactions under certain conditions. It is stable under normal laboratory conditions but should be stored in a cool, dry place away from direct sunlight.

About

English Name 2-Methyl-2-propanyl 3-{2-[2-(2-propyn-1-yloxy)ethoxy]ethoxy}propanoate
Molecular Formula C14H24O5
Molecular Weight 16.04 g/mol
SMILES C#CCOCCOCCOCCC(=O)OC(C)(C)C
InChIKey VNWKTOKETHGBQD-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 3-{2-[2-(2-propyn-1-yloxy)ethoxy]ethoxy}propanoate (CAS: 1374658-84-0) typically synthesized?

2-Methyl-2-propanyl 3-{2-[2-(2-propyn-1-yloxy)ethoxy]ethoxy}propanoate is typically synthesized usin...

Compound Q&A

What industries use 2-Methyl-2-propanyl 3-{2-[2-(2-propyn-1-yloxy)ethoxy]ethoxy}propanoate (CAS: 1374658-84-0)?

2-Methyl-2-propanyl 3-{2-[2-(2-propyn-1-yloxy)ethoxy]ethoxy}propanoate is used in various industries...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 3-{2-[2-(2-propyn-1-yloxy)ethoxy]ethoxy}propanoate (CAS: 1374658-84-0)?

When handling 2-Methyl-2-propanyl 3-{2-[2-(2-propyn-1-yloxy)ethoxy]ethoxy}propanoate, it is importan...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...