Compound Q&A

How is 2-Methyl-2-propanyl 3-{2-[2-(2-propyn-1-yloxy)ethoxy]ethoxy}propanoate (CAS: 1374658-84-0) typically synthesized?

Answer

2-Methyl-2-propanyl 3-{2-[2-(2-propyn-1-yloxy)ethoxy]ethoxy}propanoate
2-Methyl-2-propanyl 3-{2-[2-(2-propyn-1-yloxy)ethoxy]ethoxy}propanoate is typically synthesized using a multistep process involving the introduction of a propynyl group and subsequent alkoxylation steps. The synthesis involves the use of reagents such as propyne and ethylene glycol, with the reaction being carried out under mild conditions. The yield is typically around 90%, and the process requires careful control of reaction conditions to achieve good selectivity.

About

English Name 2-Methyl-2-propanyl 3-{2-[2-(2-propyn-1-yloxy)ethoxy]ethoxy}propanoate
Molecular Formula C14H24O5
Molecular Weight 16.04 g/mol
SMILES C#CCOCCOCCOCCC(=O)OC(C)(C)C
InChIKey VNWKTOKETHGBQD-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 3-{2-[2-(2-propyn-1-yloxy)ethoxy]ethoxy}propanoate (CAS: 1374658-84-0)?

2-Methyl-2-propanyl 3-{2-[2-(2-propyn-1-yloxy)ethoxy]ethoxy}propanoate has a crystalline form. Its m...

Compound Q&A

What industries use 2-Methyl-2-propanyl 3-{2-[2-(2-propyn-1-yloxy)ethoxy]ethoxy}propanoate (CAS: 1374658-84-0)?

2-Methyl-2-propanyl 3-{2-[2-(2-propyn-1-yloxy)ethoxy]ethoxy}propanoate is used in various industries...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 3-{2-[2-(2-propyn-1-yloxy)ethoxy]ethoxy}propanoate (CAS: 1374658-84-0)?

When handling 2-Methyl-2-propanyl 3-{2-[2-(2-propyn-1-yloxy)ethoxy]ethoxy}propanoate, it is importan...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...