Compound Q&A

What precautions should be taken when handling 5-(2-furyl)pyrazin-2-ol (CAS: 82619-62-3)?

Answer

5-(2-furyl)pyrazin-2-ol
When handling 5-(2-furyl)pyrazin-2-ol, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, safety glasses, and a lab coat. Work in a well-ventilated area or a fume hood to minimize exposure. Spills should be cleaned up using appropriate absorbent materials and disposed of according to local regulations. Refer to the Material Safety Data Sheet (MSDS) for detailed information on handling and storage.

About

CAS No 82619-62-3
English Name 5-(2-furyl)pyrazin-2-ol
Molecular Formula C8H6N2O2
Molecular Weight 162.15 g/mol
SMILES C1=COC(=C1)C2=CNC(=O)C=N2
InChIKey UGVAWFFQXFNGDS-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-(2-furyl)pyrazin-2-ol (CAS: 82619-62-3)?

5-(2-furyl)pyrazin-2-ol is a crystalline solid with a molecular weight of approximately 170.14 g/mol...

Compound Q&A

How is 5-(2-furyl)pyrazin-2-ol (CAS: 82619-62-3) typically synthesized?

5-(2-furyl)pyrazin-2-ol is typically synthesized through a multistep process involving the reaction ...

Compound Q&A

What industries use 5-(2-furyl)pyrazin-2-ol (CAS: 82619-62-3)?

5-(2-furyl)pyrazin-2-ol is used in various industries, particularly in pharmaceuticals where it serv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...