Compound Q&A

What are the physical and chemical properties of (E)-Naftifine (CAS: 65472-88-0)?

Answer

(E)-Naftifine
(E)-Naftifine is a white crystalline solid with a molecular weight of approximately 296.34 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. Chemically, it is relatively stable but can undergo hydrolysis under basic conditions. It is not highly reactive under normal conditions but requires careful handling to avoid degradation.

About

CAS No 65472-88-0
English Name (E)-Naftifine
Molecular Formula C21H21N
Molecular Weight 287.41 g/mol
SMILES CN(CC=CC1=CC=CC=C1)CC2=CC=CC3=CC=CC=C32
InChIKey OZGNYLLQHRPOBR-UHFFFAOYSA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

How is (E)-Naftifine (CAS: 65472-88-0) typically synthesized?

(E)-Naftifine is typically synthesized via a multi-step process involving the reaction of 2-naphthol...

Compound Q&A

What industries use (E)-Naftifine (CAS: 65472-88-0)?

(E)-Naftifine is primarily used in the pharmaceutical industry as an antifungal agent. It is also ex...

Compound Q&A

What precautions should be taken when handling (E)-Naftifine (CAS: 65472-88-0)?

When handling (E)-Naftifine, it is crucial to use proper personal protective equipment (PPE), includ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...