Compound Q&A

What industries use 4,8-Disulfo-2,6-naphthalenedicarboxylic acid (CAS: 742641-46-9)?

Answer

4,8-Disulfo-2,6-naphthalenedicarboxylic acid
4,8-Disulfo-2,6-naphthalenedicarboxylic acid finds applications in the pharmaceutical industry for the synthesis of various drug intermediates, in the polymer industry for the development of advanced materials, and in the semiconductor industry for use in electronic devices. It is also utilized in the production of sensors and as a component in certain chemical reagents.

About

English Name 4,8-Disulfo-2,6-naphthalenedicarboxylic acid
Molecular Formula C12H8O10S2
Molecular Weight 376.32 g/mol
SMILES O=C(C1=CC(S(=O)(O)=O)=C2C=C(C(O)=O)C=C(S(=O)(O)=O)C2=C1)O
InChIKey ZQWYRGRHXNAOLE-UHFFFAOYSA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,8-Disulfo-2,6-naphthalenedicarboxylic acid (CAS: 742641-46-9)?

4,8-Disulfo-2,6-naphthalenedicarboxylic acid is a crystalline solid with a high molecular weight due...

Compound Q&A

How is 4,8-Disulfo-2,6-naphthalenedicarboxylic acid (CAS: 742641-46-9) typically synthesized?

4,8-Disulfo-2,6-naphthalenedicarboxylic acid can be synthesized via the condensation of naphthalene-...

Compound Q&A

What precautions should be taken when handling 4,8-Disulfo-2,6-naphthalenedicarboxylic acid (CAS: 742641-46-9)?

When handling 4,8-Disulfo-2,6-naphthalenedicarboxylic acid, it is important to use appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...